C23H30F4 — CID 139779201
4-[4-(4-butylcyclohexyl)cyclohexen-1-yl]-1-fluoro-2-(trifluoromethyl)benzene (PubChem CID 139779201) has the molecular formula C23H30F4 and a molecular weight of 382.49 g/mol. Its IUPAC name is 4-[4-(4-butylcyclohexyl)cyclohexen-1-yl]-1-fluoro-2-(trifluoromethyl)benzene.
| Compound Name | 4-[4-(4-butylcyclohexyl)cyclohexen-1-yl]-1-fluoro-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 139779201 |
| Molecular Formula | C23H30F4 |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 4-[4-(4-butylcyclohexyl)cyclohexen-1-yl]-1-fluoro-2-(trifluoromethyl)benzene |
| SMILES | CCCCC1CCC(C2CC=C(c3ccc(F)c(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C23H30F4/c1-2-3-4-16-5-7-17(8-6-16)18-9-11-19(12-10-18)20-13-14-22(24)21(15-20)23(25,26)27/h11,13-18H,2-10,12H2,1H3 |
| InChIKey | QWVHCEZHAXMOFG-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |