C21H29F3S — CID 151155513
2-[4-(4-butylcyclohexyl)cyclohexen-1-yl]-5-(trifluoromethyl)thiophene (PubChem CID 151155513) has the molecular formula C21H29F3S and a molecular weight of 370.52 g/mol. Its IUPAC name is 2-[4-(4-butylcyclohexyl)cyclohexen-1-yl]-5-(trifluoromethyl)thiophene.
| Compound Name | 2-[4-(4-butylcyclohexyl)cyclohexen-1-yl]-5-(trifluoromethyl)thiophene |
|---|---|
| PubChem CID | 151155513 |
| Molecular Formula | C21H29F3S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-[4-(4-butylcyclohexyl)cyclohexen-1-yl]-5-(trifluoromethyl)thiophene |
| SMILES | CCCCC1CCC(C2CC=C(c3ccc(C(F)(F)F)s3)CC2)CC1 |
| InChI | InChI=1S/C21H29F3S/c1-2-3-4-15-5-7-16(8-6-15)17-9-11-18(12-10-17)19-13-14-20(25-19)21(22,23)24/h11,13-17H,2-10,12H2,1H3 |
| InChIKey | MZDLRKXBIHUZDS-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |