C18H23F3S — CID 147976403
2-[4-(4-methylcyclohexyl)cyclohexen-1-yl]-5-(trifluoromethyl)thiophene (PubChem CID 147976403) has the molecular formula C18H23F3S and a molecular weight of 328.44 g/mol. Its IUPAC name is 2-[4-(4-methylcyclohexyl)cyclohexen-1-yl]-5-(trifluoromethyl)thiophene.
| Compound Name | 2-[4-(4-methylcyclohexyl)cyclohexen-1-yl]-5-(trifluoromethyl)thiophene |
|---|---|
| PubChem CID | 147976403 |
| Molecular Formula | C18H23F3S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-[4-(4-methylcyclohexyl)cyclohexen-1-yl]-5-(trifluoromethyl)thiophene |
| SMILES | CC1CCC(C2CC=C(c3ccc(C(F)(F)F)s3)CC2)CC1 |
| InChI | InChI=1S/C18H23F3S/c1-12-2-4-13(5-3-12)14-6-8-15(9-7-14)16-10-11-17(22-16)18(19,20)21/h8,10-14H,2-7,9H2,1H3 |
| InChIKey | ISJCCTDMTJSSEF-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |