C21H30FOP — CID 166903499
[6-ethoxy-2-fluoro-3-[4-(4-methylcyclohexyl)cyclohexen-1-yl]phenyl]phosphane (PubChem CID 166903499) has the molecular formula C21H30FOP and a molecular weight of 348.44 g/mol. Its IUPAC name is [6-ethoxy-2-fluoro-3-[4-(4-methylcyclohexyl)cyclohexen-1-yl]phenyl]phosphane.
| Compound Name | [6-ethoxy-2-fluoro-3-[4-(4-methylcyclohexyl)cyclohexen-1-yl]phenyl]phosphane |
|---|---|
| PubChem CID | 166903499 |
| Molecular Formula | C21H30FOP |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | [6-ethoxy-2-fluoro-3-[4-(4-methylcyclohexyl)cyclohexen-1-yl]phenyl]phosphane |
| SMILES | CCOc1ccc(C2=CCC(C3CCC(C)CC3)CC2)c(F)c1P |
| InChI | InChI=1S/C21H30FOP/c1-3-23-19-13-12-18(20(22)21(19)24)17-10-8-16(9-11-17)15-6-4-14(2)5-7-15/h10,12-16H,3-9,11,24H2,1-2H3 |
| InChIKey | YCGMGJYTUYDJCL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|