C25H36ClFO — CID 59257238
3-chloro-1-ethoxy-2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]benzene (PubChem CID 59257238) has the molecular formula C25H36ClFO and a molecular weight of 407.01 g/mol. Its IUPAC name is 3-chloro-1-ethoxy-2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]benzene.
| Compound Name | 3-chloro-1-ethoxy-2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 59257238 |
| Molecular Formula | C25H36ClFO |
| Molecular Weight | 407.01 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 3-chloro-1-ethoxy-2-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]benzene |
| SMILES | CCCCCC1CCC(C2CC=C(c3ccc(OCC)c(F)c3Cl)CC2)CC1 |
| InChI | InChI=1S/C25H36ClFO/c1-3-5-6-7-18-8-10-19(11-9-18)20-12-14-21(15-13-20)22-16-17-23(28-4-2)25(27)24(22)26/h14,16-20H,3-13,15H2,1-2H3 |
| InChIKey | SYTCPHXMFXICNQ-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.01 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|