C16H20ClFO — CID 59257307
3-chloro-1-ethoxy-4-(4-ethylcyclohexen-1-yl)-2-fluorobenzene (PubChem CID 59257307) has the molecular formula C16H20ClFO and a molecular weight of 282.79 g/mol. Its IUPAC name is 3-chloro-1-ethoxy-4-(4-ethylcyclohexen-1-yl)-2-fluorobenzene.
| Compound Name | 3-chloro-1-ethoxy-4-(4-ethylcyclohexen-1-yl)-2-fluorobenzene |
|---|---|
| PubChem CID | 59257307 |
| Molecular Formula | C16H20ClFO |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-chloro-1-ethoxy-4-(4-ethylcyclohexen-1-yl)-2-fluorobenzene |
| SMILES | CCOc1ccc(C2=CCC(CC)CC2)c(Cl)c1F |
| InChI | InChI=1S/C16H20ClFO/c1-3-11-5-7-12(8-6-11)13-9-10-14(19-4-2)16(18)15(13)17/h7,9-11H,3-6,8H2,1-2H3 |
| InChIKey | AOZXYTUDDNKTDK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |