C23H26ClFO — CID 59257225
2-chloro-1-ethoxy-3-fluoro-4-[4-(4-propylcyclohexen-1-yl)phenyl]benzene (PubChem CID 59257225) has the molecular formula C23H26ClFO and a molecular weight of 372.91 g/mol. Its IUPAC name is 2-chloro-1-ethoxy-3-fluoro-4-[4-(4-propylcyclohexen-1-yl)phenyl]benzene.
| Compound Name | 2-chloro-1-ethoxy-3-fluoro-4-[4-(4-propylcyclohexen-1-yl)phenyl]benzene |
|---|---|
| PubChem CID | 59257225 |
| Molecular Formula | C23H26ClFO |
| Molecular Weight | 372.91 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-chloro-1-ethoxy-3-fluoro-4-[4-(4-propylcyclohexen-1-yl)phenyl]benzene |
| SMILES | CCCC1CC=C(c2ccc(-c3ccc(OCC)c(Cl)c3F)cc2)CC1 |
| InChI | InChI=1S/C23H26ClFO/c1-3-5-16-6-8-17(9-7-16)18-10-12-19(13-11-18)20-14-15-21(26-4-2)22(24)23(20)25/h8,10-16H,3-7,9H2,1-2H3 |
| InChIKey | MJZHUYAYTZHVMC-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.91 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |