C22H25ClFNO — CID 59257202
5-(3-chloro-4-ethoxy-2-fluorophenyl)-2-(4-propylcyclohexen-1-yl)pyridine (PubChem CID 59257202) has the molecular formula C22H25ClFNO and a molecular weight of 373.90 g/mol. Its IUPAC name is 5-(3-chloro-4-ethoxy-2-fluorophenyl)-2-(4-propylcyclohexen-1-yl)pyridine.
| Compound Name | 5-(3-chloro-4-ethoxy-2-fluorophenyl)-2-(4-propylcyclohexen-1-yl)pyridine |
|---|---|
| PubChem CID | 59257202 |
| Molecular Formula | C22H25ClFNO |
| Molecular Weight | 373.90 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 5-(3-chloro-4-ethoxy-2-fluorophenyl)-2-(4-propylcyclohexen-1-yl)pyridine |
| SMILES | CCCC1CC=C(c2ccc(-c3ccc(OCC)c(Cl)c3F)cn2)CC1 |
| InChI | InChI=1S/C22H25ClFNO/c1-3-5-15-6-8-16(9-7-15)19-12-10-17(14-25-19)18-11-13-20(26-4-2)21(23)22(18)24/h8,10-15H,3-7,9H2,1-2H3 |
| InChIKey | OPZRZYWMAWVWFS-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.90 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |