C18H24ClF — CID 59257313
2-chloro-3-fluoro-1-propyl-4-(4-propylcyclohexen-1-yl)benzene (PubChem CID 59257313) has the molecular formula C18H24ClF and a molecular weight of 294.84 g/mol. Its IUPAC name is 2-chloro-3-fluoro-1-propyl-4-(4-propylcyclohexen-1-yl)benzene.
| Compound Name | 2-chloro-3-fluoro-1-propyl-4-(4-propylcyclohexen-1-yl)benzene |
|---|---|
| PubChem CID | 59257313 |
| Molecular Formula | C18H24ClF |
| Molecular Weight | 294.84 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-chloro-3-fluoro-1-propyl-4-(4-propylcyclohexen-1-yl)benzene |
| SMILES | CCCc1ccc(C2=CCC(CCC)CC2)c(F)c1Cl |
| InChI | InChI=1S/C18H24ClF/c1-3-5-13-7-9-14(10-8-13)16-12-11-15(6-4-2)17(19)18(16)20/h9,11-13H,3-8,10H2,1-2H3 |
| InChIKey | YVVXEMVELFZEPW-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.84 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |