C23H26ClF — CID 59257271
2-chloro-1-[4-(4-ethylcyclohexen-1-yl)phenyl]-3-fluoro-4-propylbenzene (PubChem CID 59257271) has the molecular formula C23H26ClF and a molecular weight of 356.91 g/mol. Its IUPAC name is 2-chloro-1-[4-(4-ethylcyclohexen-1-yl)phenyl]-3-fluoro-4-propylbenzene.
| Compound Name | 2-chloro-1-[4-(4-ethylcyclohexen-1-yl)phenyl]-3-fluoro-4-propylbenzene |
|---|---|
| PubChem CID | 59257271 |
| Molecular Formula | C23H26ClF |
| Molecular Weight | 356.91 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-chloro-1-[4-(4-ethylcyclohexen-1-yl)phenyl]-3-fluoro-4-propylbenzene |
| SMILES | CCCc1ccc(-c2ccc(C3=CCC(CC)CC3)cc2)c(Cl)c1F |
| InChI | InChI=1S/C23H26ClF/c1-3-5-20-14-15-21(22(24)23(20)25)19-12-10-18(11-13-19)17-8-6-16(4-2)7-9-17/h8,10-16H,3-7,9H2,1-2H3 |
| InChIKey | HIBGXLSOFGFXSV-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.91 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |