C24H28ClF — CID 59257309
2-chloro-3-fluoro-1-[4-[2-(4-methylcyclohexen-1-yl)ethyl]phenyl]-4-propylbenzene (PubChem CID 59257309) has the molecular formula C24H28ClF and a molecular weight of 370.94 g/mol. Its IUPAC name is 2-chloro-3-fluoro-1-[4-[2-(4-methylcyclohexen-1-yl)ethyl]phenyl]-4-propylbenzene.
| Compound Name | 2-chloro-3-fluoro-1-[4-[2-(4-methylcyclohexen-1-yl)ethyl]phenyl]-4-propylbenzene |
|---|---|
| PubChem CID | 59257309 |
| Molecular Formula | C24H28ClF |
| Molecular Weight | 370.94 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-chloro-3-fluoro-1-[4-[2-(4-methylcyclohexen-1-yl)ethyl]phenyl]-4-propylbenzene |
| SMILES | CCCc1ccc(-c2ccc(CCC3=CCC(C)CC3)cc2)c(Cl)c1F |
| InChI | InChI=1S/C24H28ClF/c1-3-4-21-15-16-22(23(25)24(21)26)20-13-11-19(12-14-20)10-9-18-7-5-17(2)6-8-18/h7,11-17H,3-6,8-10H2,1-2H3 |
| InChIKey | BKHQIXKQAPKAHD-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.94 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|