C31H32ClF — CID 59257123
3-chloro-1-(4-ethylcyclohexen-1-yl)-2-fluoro-4-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]benzene (PubChem CID 59257123) has the molecular formula C31H32ClF and a molecular weight of 459.05 g/mol. Its IUPAC name is 3-chloro-1-(4-ethylcyclohexen-1-yl)-2-fluoro-4-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]benzene.
| Compound Name | 3-chloro-1-(4-ethylcyclohexen-1-yl)-2-fluoro-4-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 59257123 |
| Molecular Formula | C31H32ClF |
| Molecular Weight | 459.05 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 3-chloro-1-(4-ethylcyclohexen-1-yl)-2-fluoro-4-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]benzene |
| SMILES | C/C=C/CCc1ccc(-c2ccc(-c3ccc(C4=CCC(CC)CC4)c(F)c3Cl)cc2)cc1 |
| InChI | InChI=1S/C31H32ClF/c1-3-5-6-7-23-10-12-24(13-11-23)25-16-18-26(19-17-25)28-20-21-29(31(33)30(28)32)27-14-8-22(4-2)9-15-27/h3,5,10-14,16-22H,4,6-9,15H2,1-2H3/b5-3+ |
| InChIKey | DTKZPPGSAZVKBP-HWKANZROSA-N |
| XLogP | 9.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.05 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|