C25H28ClFO — CID 59257118
2-chloro-1-ethoxy-3-fluoro-4-[4-[4-[(E)-pent-3-enyl]phenyl]cyclohexen-1-yl]benzene (PubChem CID 59257118) has the molecular formula C25H28ClFO and a molecular weight of 398.95 g/mol. Its IUPAC name is 2-chloro-1-ethoxy-3-fluoro-4-[4-[4-[(E)-pent-3-enyl]phenyl]cyclohexen-1-yl]benzene.
| Compound Name | 2-chloro-1-ethoxy-3-fluoro-4-[4-[4-[(E)-pent-3-enyl]phenyl]cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 59257118 |
| Molecular Formula | C25H28ClFO |
| Molecular Weight | 398.95 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2-chloro-1-ethoxy-3-fluoro-4-[4-[4-[(E)-pent-3-enyl]phenyl]cyclohexen-1-yl]benzene |
| SMILES | C/C=C/CCc1ccc(C2CC=C(c3ccc(OCC)c(Cl)c3F)CC2)cc1 |
| InChI | InChI=1S/C25H28ClFO/c1-3-5-6-7-18-8-10-19(11-9-18)20-12-14-21(15-13-20)22-16-17-23(28-4-2)24(26)25(22)27/h3,5,8-11,14,16-17,20H,4,6-7,12-13,15H2,1-2H3/b5-3+ |
| InChIKey | NRGGTAADWOCLMO-HWKANZROSA-N |
| XLogP | 7.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.95 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|