C33H38F2O — CID 154607414
1-ethoxy-2,3-difluoro-4-[2-[4-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]cyclohexyl]ethyl]benzene (PubChem CID 154607414) has the molecular formula C33H38F2O and a molecular weight of 488.66 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[2-[4-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]cyclohexyl]ethyl]benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-[2-[4-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]cyclohexyl]ethyl]benzene |
|---|---|
| PubChem CID | 154607414 |
| Molecular Formula | C33H38F2O |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[2-[4-[4-[4-[(E)-pent-3-enyl]phenyl]phenyl]cyclohexyl]ethyl]benzene |
| SMILES | C/C=C/CCc1ccc(-c2ccc(C3CCC(CCc4ccc(OCC)c(F)c4F)CC3)cc2)cc1 |
| InChI | InChI=1S/C33H38F2O/c1-3-5-6-7-24-8-13-26(14-9-24)28-18-20-29(21-19-28)27-15-10-25(11-16-27)12-17-30-22-23-31(36-4-2)33(35)32(30)34/h3,5,8-9,13-14,18-23,25,27H,4,6-7,10-12,15-17H2,1-2H3/b5-3+ |
| InChIKey | PMDYZXGQWJXSOV-HWKANZROSA-N |
| XLogP | 9.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|