C26H32F2O — CID 90161573
2,3-difluoro-1-[(E)-prop-1-enoxy]-4-[2-[4-(4-propylcyclohexyl)phenyl]ethyl]benzene (PubChem CID 90161573) has the molecular formula C26H32F2O and a molecular weight of 398.54 g/mol. Its IUPAC name is 2,3-difluoro-1-[(E)-prop-1-enoxy]-4-[2-[4-(4-propylcyclohexyl)phenyl]ethyl]benzene.
| Compound Name | 2,3-difluoro-1-[(E)-prop-1-enoxy]-4-[2-[4-(4-propylcyclohexyl)phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 90161573 |
| Molecular Formula | C26H32F2O |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 2,3-difluoro-1-[(E)-prop-1-enoxy]-4-[2-[4-(4-propylcyclohexyl)phenyl]ethyl]benzene |
| SMILES | C/C=C/Oc1ccc(CCc2ccc(C3CCC(CCC)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C26H32F2O/c1-3-5-19-6-11-21(12-7-19)22-13-8-20(9-14-22)10-15-23-16-17-24(29-18-4-2)26(28)25(23)27/h4,8-9,13-14,16-19,21H,3,5-7,10-12,15H2,1-2H3/b18-4+ |
| InChIKey | ZMGOLGFIVHQISI-JJPRUIFNSA-N |
| XLogP | 7.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|