C20H22F2O — CID 90161451
2,3-difluoro-1-[(E)-prop-1-enoxy]-4-[2-(4-propylphenyl)ethyl]benzene (PubChem CID 90161451) has the molecular formula C20H22F2O and a molecular weight of 316.39 g/mol. Its IUPAC name is 2,3-difluoro-1-[(E)-prop-1-enoxy]-4-[2-(4-propylphenyl)ethyl]benzene.
| Compound Name | 2,3-difluoro-1-[(E)-prop-1-enoxy]-4-[2-(4-propylphenyl)ethyl]benzene |
|---|---|
| PubChem CID | 90161451 |
| Molecular Formula | C20H22F2O |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 2,3-difluoro-1-[(E)-prop-1-enoxy]-4-[2-(4-propylphenyl)ethyl]benzene |
| SMILES | C/C=C/Oc1ccc(CCc2ccc(CCC)cc2)c(F)c1F |
| InChI | InChI=1S/C20H22F2O/c1-3-5-15-6-8-16(9-7-15)10-11-17-12-13-18(23-14-4-2)20(22)19(17)21/h4,6-9,12-14H,3,5,10-11H2,1-2H3/b14-4+ |
| InChIKey | SBKISSSWIBJSNO-LNKIKWGQSA-N |
| XLogP | 5.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|