About 2-fluoro-1,3-dimethyl-4-[2-(4-propylphenyl)ethyl]benzene
2-fluoro-1,3-dimethyl-4-[2-(4-propylphenyl)ethyl]benzene (PubChem CID 134237119) has the molecular formula C19H23F
and a molecular weight of 270.39 g/mol. Its IUPAC name is 2-fluoro-1,3-dimethyl-4-[2-(4-propylphenyl)ethyl]benzene.
Molecular Properties
| Compound Name | 2-fluoro-1,3-dimethyl-4-[2-(4-propylphenyl)ethyl]benzene |
| PubChem CID | 134237119 |
| Molecular Formula | C19H23F |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2-fluoro-1,3-dimethyl-4-[2-(4-propylphenyl)ethyl]benzene |
| SMILES | CCCc1ccc(CCc2ccc(C)c(F)c2C)cc1 |
| InChI | InChI=1S/C19H23F/c1-4-5-16-7-9-17(10-8-16)11-13-18-12-6-14(2)19(20)15(18)3/h6-10,12H,4-5,11,13H2,1-3H3 |
| InChIKey | IWFKZYPDLUDIOJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-fluoro-1,3-dimethyl-4-[2-(4-propylphenyl)ethyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1,3-dimethyl-4-[2-(4-propylphenyl)ethyl]benzene?
The IUPAC name of 2-fluoro-1,3-dimethyl-4-[2-(4-propylphenyl)ethyl]benzene (CID 134237119) is 2-fluoro-1,3-dimethyl-4-[2-(4-propylphenyl)ethyl]benzene.
What is the SMILES notation for 2-fluoro-1,3-dimethyl-4-[2-(4-propylphenyl)ethyl]benzene?
The canonical SMILES for 2-fluoro-1,3-dimethyl-4-[2-(4-propylphenyl)ethyl]benzene is CCCc1ccc(CCc2ccc(C)c(F)c2C)cc1.
What is the InChIKey of 2-fluoro-1,3-dimethyl-4-[2-(4-propylphenyl)ethyl]benzene?
The InChIKey is IWFKZYPDLUDIOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23F/c1-4-5-16-7-9-17(10-8-16)11-13-18-12-6-14(2)19(20)15(18)3/h6-10,12H,4-5,11,13H2,1-3H3.
What are the key properties of 2-fluoro-1,3-dimethyl-4-[2-(4-propylphenyl)ethyl]benzene?
2-fluoro-1,3-dimethyl-4-[2-(4-propylphenyl)ethyl]benzene has a molecular weight of 270.39 g/mol, XLogP of 5.18, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1,3-dimethyl-4-[2-(4-propylphenyl)ethyl]benzene is sourced from PubChem (CID 134237119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).