C16H17F2N — CID 19765340
2,6-difluoro-3-[2-(4-propylphenyl)ethyl]pyridine (PubChem CID 19765340) has the molecular formula C16H17F2N and a molecular weight of 261.31 g/mol. Its IUPAC name is 2,6-difluoro-3-[2-(4-propylphenyl)ethyl]pyridine.
| Compound Name | 2,6-difluoro-3-[2-(4-propylphenyl)ethyl]pyridine |
|---|---|
| PubChem CID | 19765340 |
| Molecular Formula | C16H17F2N |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2,6-difluoro-3-[2-(4-propylphenyl)ethyl]pyridine |
| SMILES | CCCc1ccc(CCc2ccc(F)nc2F)cc1 |
| InChI | InChI=1S/C16H17F2N/c1-2-3-12-4-6-13(7-5-12)8-9-14-10-11-15(17)19-16(14)18/h4-7,10-11H,2-3,8-9H2,1H3 |
| InChIKey | JSUDKSTWIZOYAV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|