(2,3-difluoro-4-propylphenyl) 4-propylbenzoate

C19H20F2O2 — CID 54565764

IUPAC(2,3-difluoro-4-propylphenyl) 4-propylbenzoate
SMILESCCCc1ccc(C(=O)Oc2ccc(CCC)c(F)c2F)cc1
InChIInChI=1S/C19H20F2O2/c1-3-5-13-7-9-15(10-8-13)19(22)23-16-12-11-14(6-4-2)17(20)18(16)21/h7-12H,3-6H2,1-2H3
InChIKeyZTRWLXIQEHYYSZ-UHFFFAOYSA-N
MW318.36 g/mol
LogP5.09
Rot. Bonds6

About (2,3-difluoro-4-propylphenyl) 4-propylbenzoate

(2,3-difluoro-4-propylphenyl) 4-propylbenzoate (PubChem CID 54565764) has the molecular formula C19H20F2O2 and a molecular weight of 318.36 g/mol. Its IUPAC name is (2,3-difluoro-4-propylphenyl) 4-propylbenzoate.

Molecular Properties

Compound Name(2,3-difluoro-4-propylphenyl) 4-propylbenzoate
PubChem CID54565764
Molecular FormulaC19H20F2O2
Molecular Weight318.36 g/mol
Exact Mass318.14
IUPAC Name(2,3-difluoro-4-propylphenyl) 4-propylbenzoate
SMILESCCCc1ccc(C(=O)Oc2ccc(CCC)c(F)c2F)cc1
InChIInChI=1S/C19H20F2O2/c1-3-5-13-7-9-15(10-8-13)19(22)23-16-12-11-14(6-4-2)17(20)18(16)21/h7-12H,3-6H2,1-2H3
InChIKeyZTRWLXIQEHYYSZ-UHFFFAOYSA-N
XLogP5.09
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500318.36
LogP ≤ 55.09
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (2,3-difluoro-4-propylphenyl) 4-propylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,3-difluoro-4-propylphenyl) 4-propylbenzoate?
The IUPAC name of (2,3-difluoro-4-propylphenyl) 4-propylbenzoate (CID 54565764) is (2,3-difluoro-4-propylphenyl) 4-propylbenzoate.
What is the SMILES notation for (2,3-difluoro-4-propylphenyl) 4-propylbenzoate?
The canonical SMILES for (2,3-difluoro-4-propylphenyl) 4-propylbenzoate is CCCc1ccc(C(=O)Oc2ccc(CCC)c(F)c2F)cc1.
What is the InChIKey of (2,3-difluoro-4-propylphenyl) 4-propylbenzoate?
The InChIKey is ZTRWLXIQEHYYSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F2O2/c1-3-5-13-7-9-15(10-8-13)19(22)23-16-12-11-14(6-4-2)17(20)18(16)21/h7-12H,3-6H2,1-2H3.
What are the key properties of (2,3-difluoro-4-propylphenyl) 4-propylbenzoate?
(2,3-difluoro-4-propylphenyl) 4-propylbenzoate has a molecular weight of 318.36 g/mol, XLogP of 5.09, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-difluoro-4-propylphenyl) 4-propylbenzoate is sourced from PubChem (CID 54565764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).