C20H22F2O3 — CID 14495676
(2,3-difluoro-4-pentylphenyl) 4-ethoxybenzoate (PubChem CID 14495676) has the molecular formula C20H22F2O3 and a molecular weight of 348.39 g/mol. Its IUPAC name is (2,3-difluoro-4-pentylphenyl) 4-ethoxybenzoate.
| Compound Name | (2,3-difluoro-4-pentylphenyl) 4-ethoxybenzoate |
|---|---|
| PubChem CID | 14495676 |
| Molecular Formula | C20H22F2O3 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (2,3-difluoro-4-pentylphenyl) 4-ethoxybenzoate |
| SMILES | CCCCCc1ccc(OC(=O)c2ccc(OCC)cc2)c(F)c1F |
| InChI | InChI=1S/C20H22F2O3/c1-3-5-6-7-14-10-13-17(19(22)18(14)21)25-20(23)15-8-11-16(12-9-15)24-4-2/h8-13H,3-7H2,1-2H3 |
| InChIKey | WDNREMRDNJSDNA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|