C30H32F2O2 — CID 54280882
(4-but-3-enyl-2,3-difluorophenyl) 4-(4-heptylphenyl)benzoate (PubChem CID 54280882) has the molecular formula C30H32F2O2 and a molecular weight of 462.58 g/mol. Its IUPAC name is (4-but-3-enyl-2,3-difluorophenyl) 4-(4-heptylphenyl)benzoate.
| Compound Name | (4-but-3-enyl-2,3-difluorophenyl) 4-(4-heptylphenyl)benzoate |
|---|---|
| PubChem CID | 54280882 |
| Molecular Formula | C30H32F2O2 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | (4-but-3-enyl-2,3-difluorophenyl) 4-(4-heptylphenyl)benzoate |
| SMILES | C=CCCc1ccc(OC(=O)c2ccc(-c3ccc(CCCCCCC)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C30H32F2O2/c1-3-5-7-8-9-10-22-12-14-23(15-13-22)24-16-18-26(19-17-24)30(33)34-27-21-20-25(11-6-4-2)28(31)29(27)32/h4,12-21H,2-3,5-11H2,1H3 |
| InChIKey | RQRZVFCZPZAZKG-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|