C23H28F2O2 — CID 54220318
(2,3-difluoro-4-pentylphenyl) 4-pentylbenzoate (PubChem CID 54220318) has the molecular formula C23H28F2O2 and a molecular weight of 374.47 g/mol. Its IUPAC name is (2,3-difluoro-4-pentylphenyl) 4-pentylbenzoate.
| Compound Name | (2,3-difluoro-4-pentylphenyl) 4-pentylbenzoate |
|---|---|
| PubChem CID | 54220318 |
| Molecular Formula | C23H28F2O2 |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (2,3-difluoro-4-pentylphenyl) 4-pentylbenzoate |
| SMILES | CCCCCc1ccc(C(=O)Oc2ccc(CCCCC)c(F)c2F)cc1 |
| InChI | InChI=1S/C23H28F2O2/c1-3-5-7-9-17-11-13-19(14-12-17)23(26)27-20-16-15-18(10-8-6-4-2)21(24)22(20)25/h11-16H,3-10H2,1-2H3 |
| InChIKey | QCCXAXOVULPFEN-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|