C36H46O4 — CID 70631476
bis(2,4-dibutylphenyl) benzene-1,4-dicarboxylate (PubChem CID 70631476) has the molecular formula C36H46O4 and a molecular weight of 542.76 g/mol. Its IUPAC name is bis(2,4-dibutylphenyl) benzene-1,4-dicarboxylate.
| Compound Name | bis(2,4-dibutylphenyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 70631476 |
| Molecular Formula | C36H46O4 |
| Molecular Weight | 542.76 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | bis(2,4-dibutylphenyl) benzene-1,4-dicarboxylate |
| SMILES | CCCCc1ccc(OC(=O)c2ccc(C(=O)Oc3ccc(CCCC)cc3CCCC)cc2)c(CCCC)c1 |
| InChI | InChI=1S/C36H46O4/c1-5-9-13-27-17-23-33(31(25-27)15-11-7-3)39-35(37)29-19-21-30(22-20-29)36(38)40-34-24-18-28(14-10-6-2)26-32(34)16-12-8-4/h17-26H,5-16H2,1-4H3 |
| InChIKey | YDMPHJSCBRPPFR-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.76 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|