C40H54O4 — CID 70631411
bis(2,4-dipentylphenyl) benzene-1,4-dicarboxylate (PubChem CID 70631411) has the molecular formula C40H54O4 and a molecular weight of 598.87 g/mol. Its IUPAC name is bis(2,4-dipentylphenyl) benzene-1,4-dicarboxylate.
| Compound Name | bis(2,4-dipentylphenyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 70631411 |
| Molecular Formula | C40H54O4 |
| Molecular Weight | 598.87 g/mol |
| Exact Mass | 598.40 |
| IUPAC Name | bis(2,4-dipentylphenyl) benzene-1,4-dicarboxylate |
| SMILES | CCCCCc1ccc(OC(=O)c2ccc(C(=O)Oc3ccc(CCCCC)cc3CCCCC)cc2)c(CCCCC)c1 |
| InChI | InChI=1S/C40H54O4/c1-5-9-13-17-31-21-27-37(35(29-31)19-15-11-7-3)43-39(41)33-23-25-34(26-24-33)40(42)44-38-28-22-32(18-14-10-6-2)30-36(38)20-16-12-8-4/h21-30H,5-20H2,1-4H3 |
| InChIKey | RYTKAKJZZBJQJP-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.87 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|