About (4-pentylbenzoyl) 4-pentylbenzoate
(4-pentylbenzoyl) 4-pentylbenzoate (PubChem CID 12513442) has the molecular formula C24H30O3
and a molecular weight of 366.50 g/mol. Its IUPAC name is (4-pentylbenzoyl) 4-pentylbenzoate.
Molecular Properties
| Compound Name | (4-pentylbenzoyl) 4-pentylbenzoate |
| PubChem CID | 12513442 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (4-pentylbenzoyl) 4-pentylbenzoate |
| SMILES | CCCCCc1ccc(C(=O)OC(=O)c2ccc(CCCCC)cc2)cc1 |
| InChI | InChI=1S/C24H30O3/c1-3-5-7-9-19-11-15-21(16-12-19)23(25)27-24(26)22-17-13-20(14-18-22)10-8-6-4-2/h11-18H,3-10H2,1-2H3 |
| InChIKey | AGAOEJJEGXQMGX-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (4-pentylbenzoyl) 4-pentylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-pentylbenzoyl) 4-pentylbenzoate?
The IUPAC name of (4-pentylbenzoyl) 4-pentylbenzoate (CID 12513442) is (4-pentylbenzoyl) 4-pentylbenzoate.
What is the SMILES notation for (4-pentylbenzoyl) 4-pentylbenzoate?
The canonical SMILES for (4-pentylbenzoyl) 4-pentylbenzoate is CCCCCc1ccc(C(=O)OC(=O)c2ccc(CCCCC)cc2)cc1.
What is the InChIKey of (4-pentylbenzoyl) 4-pentylbenzoate?
The InChIKey is AGAOEJJEGXQMGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30O3/c1-3-5-7-9-19-11-15-21(16-12-19)23(25)27-24(26)22-17-13-20(14-18-22)10-8-6-4-2/h11-18H,3-10H2,1-2H3.
What are the key properties of (4-pentylbenzoyl) 4-pentylbenzoate?
(4-pentylbenzoyl) 4-pentylbenzoate has a molecular weight of 366.50 g/mol, XLogP of 6.15, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-pentylbenzoyl) 4-pentylbenzoate is sourced from PubChem (CID 12513442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).