About amino 4-butylbenzoate
amino 4-butylbenzoate (PubChem CID 68976158) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is amino 4-butylbenzoate.
Molecular Properties
| Compound Name | amino 4-butylbenzoate |
| PubChem CID | 68976158 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | amino 4-butylbenzoate |
| SMILES | CCCCc1ccc(C(=O)ON)cc1 |
| InChI | InChI=1S/C11H15NO2/c1-2-3-4-9-5-7-10(8-6-9)11(13)14-12/h5-8H,2-4,12H2,1H3 |
| InChIKey | VVMKBBMJTBBDBF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 4-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 4-butylbenzoate?
The IUPAC name of amino 4-butylbenzoate (CID 68976158) is amino 4-butylbenzoate.
What is the SMILES notation for amino 4-butylbenzoate?
The canonical SMILES for amino 4-butylbenzoate is CCCCc1ccc(C(=O)ON)cc1.
What is the InChIKey of amino 4-butylbenzoate?
The InChIKey is VVMKBBMJTBBDBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-2-3-4-9-5-7-10(8-6-9)11(13)14-12/h5-8H,2-4,12H2,1H3.
What are the key properties of amino 4-butylbenzoate?
amino 4-butylbenzoate has a molecular weight of 193.25 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for amino 4-butylbenzoate is sourced from PubChem (CID 68976158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).