About (2-ethoxy-2-oxoethyl) 4-butylbenzoate
(2-ethoxy-2-oxoethyl) 4-butylbenzoate (PubChem CID 174942004) has the molecular formula C15H20O4
and a molecular weight of 264.32 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl) 4-butylbenzoate.
Molecular Properties
| Compound Name | (2-ethoxy-2-oxoethyl) 4-butylbenzoate |
| PubChem CID | 174942004 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (2-ethoxy-2-oxoethyl) 4-butylbenzoate |
| SMILES | CCCCc1ccc(C(=O)OCC(=O)OCC)cc1 |
| InChI | InChI=1S/C15H20O4/c1-3-5-6-12-7-9-13(10-8-12)15(17)19-11-14(16)18-4-2/h7-10H,3-6,11H2,1-2H3 |
| InChIKey | ZOCVDZFUXNQSCM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-ethoxy-2-oxoethyl) 4-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxy-2-oxoethyl) 4-butylbenzoate?
The IUPAC name of (2-ethoxy-2-oxoethyl) 4-butylbenzoate (CID 174942004) is (2-ethoxy-2-oxoethyl) 4-butylbenzoate.
What is the SMILES notation for (2-ethoxy-2-oxoethyl) 4-butylbenzoate?
The canonical SMILES for (2-ethoxy-2-oxoethyl) 4-butylbenzoate is CCCCc1ccc(C(=O)OCC(=O)OCC)cc1.
What is the InChIKey of (2-ethoxy-2-oxoethyl) 4-butylbenzoate?
The InChIKey is ZOCVDZFUXNQSCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4/c1-3-5-6-12-7-9-13(10-8-12)15(17)19-11-14(16)18-4-2/h7-10H,3-6,11H2,1-2H3.
What are the key properties of (2-ethoxy-2-oxoethyl) 4-butylbenzoate?
(2-ethoxy-2-oxoethyl) 4-butylbenzoate has a molecular weight of 264.32 g/mol, XLogP of 2.75, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxy-2-oxoethyl) 4-butylbenzoate is sourced from PubChem (CID 174942004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).