About 4-pentylbenzoyl bromide
4-pentylbenzoyl bromide (PubChem CID 87349955) has the molecular formula C12H15BrO
and a molecular weight of 255.15 g/mol. Its IUPAC name is 4-pentylbenzoyl bromide.
Molecular Properties
| Compound Name | 4-pentylbenzoyl bromide |
| PubChem CID | 87349955 |
| Molecular Formula | C12H15BrO |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 4-pentylbenzoyl bromide |
| SMILES | CCCCCc1ccc(C(=O)Br)cc1 |
| InChI | InChI=1S/C12H15BrO/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9H,2-5H2,1H3 |
| InChIKey | CZZRVELOZKQQQG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-pentylbenzoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pentylbenzoyl bromide?
The IUPAC name of 4-pentylbenzoyl bromide (CID 87349955) is 4-pentylbenzoyl bromide.
What is the SMILES notation for 4-pentylbenzoyl bromide?
The canonical SMILES for 4-pentylbenzoyl bromide is CCCCCc1ccc(C(=O)Br)cc1.
What is the InChIKey of 4-pentylbenzoyl bromide?
The InChIKey is CZZRVELOZKQQQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrO/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9H,2-5H2,1H3.
What are the key properties of 4-pentylbenzoyl bromide?
4-pentylbenzoyl bromide has a molecular weight of 255.15 g/mol, XLogP of 3.95, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pentylbenzoyl bromide is sourced from PubChem (CID 87349955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).