C28H25F2NO4 — CID 23052017
[4-(4-cyano-2,3-difluorophenoxy)carbonylphenyl] 4-heptylbenzoate (PubChem CID 23052017) has the molecular formula C28H25F2NO4 and a molecular weight of 477.51 g/mol. Its IUPAC name is [4-(4-cyano-2,3-difluorophenoxy)carbonylphenyl] 4-heptylbenzoate.
| Compound Name | [4-(4-cyano-2,3-difluorophenoxy)carbonylphenyl] 4-heptylbenzoate |
|---|---|
| PubChem CID | 23052017 |
| Molecular Formula | C28H25F2NO4 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | [4-(4-cyano-2,3-difluorophenoxy)carbonylphenyl] 4-heptylbenzoate |
| SMILES | CCCCCCCc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(C#N)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C28H25F2NO4/c1-2-3-4-5-6-7-19-8-10-20(11-9-19)27(32)34-23-15-12-21(13-16-23)28(33)35-24-17-14-22(18-31)25(29)26(24)30/h8-17H,2-7H2,1H3 |
| InChIKey | FKEWFSLBSVGTCV-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|