C16H9F2NO4 — CID 23052093
(4-cyano-2,3-difluorophenyl) 4-acetyloxybenzoate (PubChem CID 23052093) has the molecular formula C16H9F2NO4 and a molecular weight of 317.25 g/mol. Its IUPAC name is (4-cyano-2,3-difluorophenyl) 4-acetyloxybenzoate.
| Compound Name | (4-cyano-2,3-difluorophenyl) 4-acetyloxybenzoate |
|---|---|
| PubChem CID | 23052093 |
| Molecular Formula | C16H9F2NO4 |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | (4-cyano-2,3-difluorophenyl) 4-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccc(C(=O)Oc2ccc(C#N)c(F)c2F)cc1 |
| InChI | InChI=1S/C16H9F2NO4/c1-9(20)22-12-5-2-10(3-6-12)16(21)23-13-7-4-11(8-19)14(17)15(13)18/h2-7H,1H3 |
| InChIKey | OKMOIEMLITVIRQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|