C24H25F2NO2 — CID 19103692
(4-cyano-2,3-difluorophenyl) 4-(4-butylcyclohexyl)benzoate (PubChem CID 19103692) has the molecular formula C24H25F2NO2 and a molecular weight of 397.47 g/mol. Its IUPAC name is (4-cyano-2,3-difluorophenyl) 4-(4-butylcyclohexyl)benzoate.
| Compound Name | (4-cyano-2,3-difluorophenyl) 4-(4-butylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 19103692 |
| Molecular Formula | C24H25F2NO2 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | (4-cyano-2,3-difluorophenyl) 4-(4-butylcyclohexyl)benzoate |
| SMILES | CCCCC1CCC(c2ccc(C(=O)Oc3ccc(C#N)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C24H25F2NO2/c1-2-3-4-16-5-7-17(8-6-16)18-9-11-19(12-10-18)24(28)29-21-14-13-20(15-27)22(25)23(21)26/h9-14,16-17H,2-8H2,1H3 |
| InChIKey | PQEAKSMRIRJTTC-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|