(2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate

C24H27NO2 — CID 54145493

IUPAC(2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate
SMILESCCCC1CCC(c2ccc(C(=O)Oc3ccc(C)cc3C#N)cc2)CC1
InChIInChI=1S/C24H27NO2/c1-3-4-18-6-8-19(9-7-18)20-10-12-21(13-11-20)24(26)27-23-14-5-17(2)15-22(23)16-25/h5,10-15,18-19H,3-4,6-9H2,1-2H3
InChIKeyOECARGUNXJTAFB-UHFFFAOYSA-N
MW361.49 g/mol
LogP6.16
Rot. Bonds5

About (2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate

(2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate (PubChem CID 54145493) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is (2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate.

Molecular Properties

Compound Name(2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate
PubChem CID54145493
Molecular FormulaC24H27NO2
Molecular Weight361.49 g/mol
Exact Mass361.20
IUPAC Name(2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate
SMILESCCCC1CCC(c2ccc(C(=O)Oc3ccc(C)cc3C#N)cc2)CC1
InChIInChI=1S/C24H27NO2/c1-3-4-18-6-8-19(9-7-18)20-10-12-21(13-11-20)24(26)27-23-14-5-17(2)15-22(23)16-25/h5,10-15,18-19H,3-4,6-9H2,1-2H3
InChIKeyOECARGUNXJTAFB-UHFFFAOYSA-N
XLogP6.16
TPSA50.09 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500361.49
LogP ≤ 56.16
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate?
The IUPAC name of (2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate (CID 54145493) is (2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate.
What is the SMILES notation for (2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate?
The canonical SMILES for (2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate is CCCC1CCC(c2ccc(C(=O)Oc3ccc(C)cc3C#N)cc2)CC1.
What is the InChIKey of (2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate?
The InChIKey is OECARGUNXJTAFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27NO2/c1-3-4-18-6-8-19(9-7-18)20-10-12-21(13-11-20)24(26)27-23-14-5-17(2)15-22(23)16-25/h5,10-15,18-19H,3-4,6-9H2,1-2H3.
What are the key properties of (2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate?
(2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate has a molecular weight of 361.49 g/mol, XLogP of 6.16, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate is sourced from PubChem (CID 54145493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).