C24H27NO2 — CID 54145493
(2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate (PubChem CID 54145493) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is (2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate.
| Compound Name | (2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 54145493 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (2-cyano-4-methylphenyl) 4-(4-propylcyclohexyl)benzoate |
| SMILES | CCCC1CCC(c2ccc(C(=O)Oc3ccc(C)cc3C#N)cc2)CC1 |
| InChI | InChI=1S/C24H27NO2/c1-3-4-18-6-8-19(9-7-18)20-10-12-21(13-11-20)24(26)27-23-14-5-17(2)15-22(23)16-25/h5,10-15,18-19H,3-4,6-9H2,1-2H3 |
| InChIKey | OECARGUNXJTAFB-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|