C18H24F3NO6S2 — CID 174961403
[2-cyano-4-(4-propylcyclohexyl)phenyl] trifluoromethanesulfonate;methanesulfonic acid (PubChem CID 174961403) has the molecular formula C18H24F3NO6S2 and a molecular weight of 471.52 g/mol. Its IUPAC name is [2-cyano-4-(4-propylcyclohexyl)phenyl] trifluoromethanesulfonate;methanesulfonic acid.
| Compound Name | [2-cyano-4-(4-propylcyclohexyl)phenyl] trifluoromethanesulfonate;methanesulfonic acid |
|---|---|
| PubChem CID | 174961403 |
| Molecular Formula | C18H24F3NO6S2 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | [2-cyano-4-(4-propylcyclohexyl)phenyl] trifluoromethanesulfonate;methanesulfonic acid |
| SMILES | CCCC1CCC(c2ccc(OS(=O)(=O)C(F)(F)F)c(C#N)c2)CC1.CS(=O)(=O)O |
| InChI | InChI=1S/C17H20F3NO3S.CH4O3S/c1-2-3-12-4-6-13(7-5-12)14-8-9-16(15(10-14)11-21)24-25(22,23)17(18,19)20;1-5(2,3)4/h8-10,12-13H,2-7H2,1H3;1H3,(H,2,3,4) |
| InChIKey | MPFRNLGTHMYJLG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|