C17H21F2NO — CID 23052003
2,3-difluoro-4-[(4-propylcyclohexyl)methoxy]benzonitrile (PubChem CID 23052003) has the molecular formula C17H21F2NO and a molecular weight of 293.36 g/mol. Its IUPAC name is 2,3-difluoro-4-[(4-propylcyclohexyl)methoxy]benzonitrile.
| Compound Name | 2,3-difluoro-4-[(4-propylcyclohexyl)methoxy]benzonitrile |
|---|---|
| PubChem CID | 23052003 |
| Molecular Formula | C17H21F2NO |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2,3-difluoro-4-[(4-propylcyclohexyl)methoxy]benzonitrile |
| SMILES | CCCC1CCC(COc2ccc(C#N)c(F)c2F)CC1 |
| InChI | InChI=1S/C17H21F2NO/c1-2-3-12-4-6-13(7-5-12)11-21-15-9-8-14(10-20)16(18)17(15)19/h8-9,12-13H,2-7,11H2,1H3 |
| InChIKey | UWCBUIWOYSXYIQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |