C26H31F2NO2 — CID 23052126
2,3-difluoro-4-[[4-(4-hexoxyphenyl)cyclohexyl]methoxy]benzonitrile (PubChem CID 23052126) has the molecular formula C26H31F2NO2 and a molecular weight of 427.54 g/mol. Its IUPAC name is 2,3-difluoro-4-[[4-(4-hexoxyphenyl)cyclohexyl]methoxy]benzonitrile.
| Compound Name | 2,3-difluoro-4-[[4-(4-hexoxyphenyl)cyclohexyl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 23052126 |
| Molecular Formula | C26H31F2NO2 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 2,3-difluoro-4-[[4-(4-hexoxyphenyl)cyclohexyl]methoxy]benzonitrile |
| SMILES | CCCCCCOc1ccc(C2CCC(COc3ccc(C#N)c(F)c3F)CC2)cc1 |
| InChI | InChI=1S/C26H31F2NO2/c1-2-3-4-5-16-30-23-13-10-21(11-14-23)20-8-6-19(7-9-20)18-31-24-15-12-22(17-29)25(27)26(24)28/h10-15,19-20H,2-9,16,18H2,1H3 |
| InChIKey | DHEHEVXXXRVSHH-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|