C26H37F2NO2 — CID 18639252
2,3-difluoro-4-[[4-(4-hexoxycyclohexyl)cyclohexyl]methoxy]benzonitrile (PubChem CID 18639252) has the molecular formula C26H37F2NO2 and a molecular weight of 433.58 g/mol. Its IUPAC name is 2,3-difluoro-4-[[4-(4-hexoxycyclohexyl)cyclohexyl]methoxy]benzonitrile.
| Compound Name | 2,3-difluoro-4-[[4-(4-hexoxycyclohexyl)cyclohexyl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 18639252 |
| Molecular Formula | C26H37F2NO2 |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | 2,3-difluoro-4-[[4-(4-hexoxycyclohexyl)cyclohexyl]methoxy]benzonitrile |
| SMILES | CCCCCCOC1CCC(C2CCC(COc3ccc(C#N)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C26H37F2NO2/c1-2-3-4-5-16-30-23-13-10-21(11-14-23)20-8-6-19(7-9-20)18-31-24-15-12-22(17-29)25(27)26(24)28/h12,15,19-21,23H,2-11,13-14,16,18H2,1H3 |
| InChIKey | CLHQGYNCTRNERI-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|