C27H31NO — CID 139762011
5-butoxy-2-[2-[4-(4-ethylcyclohexyl)phenyl]ethynyl]benzonitrile (PubChem CID 139762011) has the molecular formula C27H31NO and a molecular weight of 385.55 g/mol. Its IUPAC name is 5-butoxy-2-[2-[4-(4-ethylcyclohexyl)phenyl]ethynyl]benzonitrile.
| Compound Name | 5-butoxy-2-[2-[4-(4-ethylcyclohexyl)phenyl]ethynyl]benzonitrile |
|---|---|
| PubChem CID | 139762011 |
| Molecular Formula | C27H31NO |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 5-butoxy-2-[2-[4-(4-ethylcyclohexyl)phenyl]ethynyl]benzonitrile |
| SMILES | CCCCOc1ccc(C#Cc2ccc(C3CCC(CC)CC3)cc2)c(C#N)c1 |
| InChI | InChI=1S/C27H31NO/c1-3-5-18-29-27-17-16-25(26(19-27)20-28)15-10-22-8-13-24(14-9-22)23-11-6-21(4-2)7-12-23/h8-9,13-14,16-17,19,21,23H,3-7,11-12,18H2,1-2H3 |
| InChIKey | NLLRRUNHCKBQPE-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|