C27H31N — CID 139761980
5-[2-[4-(4-butylcyclohexyl)phenyl]ethynyl]-2-ethylbenzonitrile (PubChem CID 139761980) has the molecular formula C27H31N and a molecular weight of 369.55 g/mol. Its IUPAC name is 5-[2-[4-(4-butylcyclohexyl)phenyl]ethynyl]-2-ethylbenzonitrile.
| Compound Name | 5-[2-[4-(4-butylcyclohexyl)phenyl]ethynyl]-2-ethylbenzonitrile |
|---|---|
| PubChem CID | 139761980 |
| Molecular Formula | C27H31N |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 5-[2-[4-(4-butylcyclohexyl)phenyl]ethynyl]-2-ethylbenzonitrile |
| SMILES | CCCCC1CCC(c2ccc(C#Cc3ccc(CC)c(C#N)c3)cc2)CC1 |
| InChI | InChI=1S/C27H31N/c1-3-5-6-21-9-15-25(16-10-21)26-17-11-22(12-18-26)7-8-23-13-14-24(4-2)27(19-23)20-28/h11-14,17-19,21,25H,3-6,9-10,15-16H2,1-2H3 |
| InChIKey | WRTGVTGBIVDJEB-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|