C25H28I2 — CID 174352338
5-[2-[4-(4-butylcyclohexyl)phenyl]ethynyl]-1,3-diiodo-2-methylbenzene (PubChem CID 174352338) has the molecular formula C25H28I2 and a molecular weight of 582.31 g/mol. Its IUPAC name is 5-[2-[4-(4-butylcyclohexyl)phenyl]ethynyl]-1,3-diiodo-2-methylbenzene.
| Compound Name | 5-[2-[4-(4-butylcyclohexyl)phenyl]ethynyl]-1,3-diiodo-2-methylbenzene |
|---|---|
| PubChem CID | 174352338 |
| Molecular Formula | C25H28I2 |
| Molecular Weight | 582.31 g/mol |
| Exact Mass | 582.03 |
| IUPAC Name | 5-[2-[4-(4-butylcyclohexyl)phenyl]ethynyl]-1,3-diiodo-2-methylbenzene |
| SMILES | CCCCC1CCC(c2ccc(C#Cc3cc(I)c(C)c(I)c3)cc2)CC1 |
| InChI | InChI=1S/C25H28I2/c1-3-4-5-19-8-12-22(13-9-19)23-14-10-20(11-15-23)6-7-21-16-24(26)18(2)25(27)17-21/h10-11,14-17,19,22H,3-5,8-9,12-13H2,1-2H3 |
| InChIKey | HEUVJUFJDNLYNZ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.31 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|