C26H31BrO — CID 139762044
2-bromo-4-[2-[4-(4-butylcyclohexyl)phenyl]ethynyl]-1-ethoxybenzene (PubChem CID 139762044) has the molecular formula C26H31BrO and a molecular weight of 439.44 g/mol. Its IUPAC name is 2-bromo-4-[2-[4-(4-butylcyclohexyl)phenyl]ethynyl]-1-ethoxybenzene.
| Compound Name | 2-bromo-4-[2-[4-(4-butylcyclohexyl)phenyl]ethynyl]-1-ethoxybenzene |
|---|---|
| PubChem CID | 139762044 |
| Molecular Formula | C26H31BrO |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 2-bromo-4-[2-[4-(4-butylcyclohexyl)phenyl]ethynyl]-1-ethoxybenzene |
| SMILES | CCCCC1CCC(c2ccc(C#Cc3ccc(OCC)c(Br)c3)cc2)CC1 |
| InChI | InChI=1S/C26H31BrO/c1-3-5-6-20-9-14-23(15-10-20)24-16-11-21(12-17-24)7-8-22-13-18-26(28-4-2)25(27)19-22/h11-13,16-20,23H,3-6,9-10,14-15H2,1-2H3 |
| InChIKey | ZFLQWLMTIUCUNA-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|