C25H26FN — CID 70382865
4-[2-[4-(4-butylcyclohexyl)phenyl]ethynyl]-2-fluorobenzonitrile (PubChem CID 70382865) has the molecular formula C25H26FN and a molecular weight of 359.49 g/mol. Its IUPAC name is 4-[2-[4-(4-butylcyclohexyl)phenyl]ethynyl]-2-fluorobenzonitrile.
| Compound Name | 4-[2-[4-(4-butylcyclohexyl)phenyl]ethynyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 70382865 |
| Molecular Formula | C25H26FN |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 4-[2-[4-(4-butylcyclohexyl)phenyl]ethynyl]-2-fluorobenzonitrile |
| SMILES | CCCCC1CCC(c2ccc(C#Cc3ccc(C#N)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C25H26FN/c1-2-3-4-19-7-12-22(13-8-19)23-14-9-20(10-15-23)5-6-21-11-16-24(18-27)25(26)17-21/h9-11,14-17,19,22H,2-4,7-8,12-13H2,1H3 |
| InChIKey | PDBVYBLWKKKESZ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|