C30H27F2N — CID 102416028
2,6-difluoro-4-[4-[2-[4-(4-propylcyclohexyl)phenyl]ethynyl]phenyl]benzonitrile (PubChem CID 102416028) has the molecular formula C30H27F2N and a molecular weight of 439.55 g/mol. Its IUPAC name is 2,6-difluoro-4-[4-[2-[4-(4-propylcyclohexyl)phenyl]ethynyl]phenyl]benzonitrile.
| Compound Name | 2,6-difluoro-4-[4-[2-[4-(4-propylcyclohexyl)phenyl]ethynyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 102416028 |
| Molecular Formula | C30H27F2N |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 2,6-difluoro-4-[4-[2-[4-(4-propylcyclohexyl)phenyl]ethynyl]phenyl]benzonitrile |
| SMILES | CCCC1CCC(c2ccc(C#Cc3ccc(-c4cc(F)c(C#N)c(F)c4)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H27F2N/c1-2-3-21-6-12-24(13-7-21)25-14-8-22(9-15-25)4-5-23-10-16-26(17-11-23)27-18-29(31)28(20-33)30(32)19-27/h8-11,14-19,21,24H,2-3,6-7,12-13H2,1H3 |
| InChIKey | QVUSHUWRFXTCTE-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|