C23H24N2 — CID 22590745
4-[4-(4-propylcyclohexyl)phenyl]benzene-1,2-dicarbonitrile (PubChem CID 22590745) has the molecular formula C23H24N2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 4-[4-(4-propylcyclohexyl)phenyl]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[4-(4-propylcyclohexyl)phenyl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 22590745 |
| Molecular Formula | C23H24N2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 4-[4-(4-propylcyclohexyl)phenyl]benzene-1,2-dicarbonitrile |
| SMILES | CCCC1CCC(c2ccc(-c3ccc(C#N)c(C#N)c3)cc2)CC1 |
| InChI | InChI=1S/C23H24N2/c1-2-3-17-4-6-18(7-5-17)19-8-10-20(11-9-19)21-12-13-22(15-24)23(14-21)16-25/h8-14,17-18H,2-7H2,1H3 |
| InChIKey | MZNSLYMNONLGNZ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |