C36H42N2O — CID 70521482
3-(4-heptoxyphenyl)-5-[4-(4-propylcyclohexyl)phenyl]benzene-1,2-dicarbonitrile (PubChem CID 70521482) has the molecular formula C36H42N2O and a molecular weight of 518.75 g/mol. Its IUPAC name is 3-(4-heptoxyphenyl)-5-[4-(4-propylcyclohexyl)phenyl]benzene-1,2-dicarbonitrile.
| Compound Name | 3-(4-heptoxyphenyl)-5-[4-(4-propylcyclohexyl)phenyl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 70521482 |
| Molecular Formula | C36H42N2O |
| Molecular Weight | 518.75 g/mol |
| Exact Mass | 518.33 |
| IUPAC Name | 3-(4-heptoxyphenyl)-5-[4-(4-propylcyclohexyl)phenyl]benzene-1,2-dicarbonitrile |
| SMILES | CCCCCCCOc1ccc(-c2cc(-c3ccc(C4CCC(CCC)CC4)cc3)cc(C#N)c2C#N)cc1 |
| InChI | InChI=1S/C36H42N2O/c1-3-5-6-7-8-22-39-34-20-18-31(19-21-34)35-24-32(23-33(25-37)36(35)26-38)30-16-14-29(15-17-30)28-12-10-27(9-4-2)11-13-28/h14-21,23-24,27-28H,3-13,22H2,1-2H3 |
| InChIKey | KGVGEOPXOHOCPX-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.75 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|