C27H34FNSi — CID 54734121
2-fluoro-4-[4-[1-(4-propylcyclohexyl)silinan-4-yl]phenyl]benzonitrile (PubChem CID 54734121) has the molecular formula C27H34FNSi and a molecular weight of 419.66 g/mol. Its IUPAC name is 2-fluoro-4-[4-[1-(4-propylcyclohexyl)silinan-4-yl]phenyl]benzonitrile.
| Compound Name | 2-fluoro-4-[4-[1-(4-propylcyclohexyl)silinan-4-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 54734121 |
| Molecular Formula | C27H34FNSi |
| Molecular Weight | 419.66 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 2-fluoro-4-[4-[1-(4-propylcyclohexyl)silinan-4-yl]phenyl]benzonitrile |
| SMILES | CCCC1CCC([SiH]2CCC(c3ccc(-c4ccc(C#N)c(F)c4)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H34FNSi/c1-2-3-20-4-12-26(13-5-20)30-16-14-23(15-17-30)21-6-8-22(9-7-21)24-10-11-25(19-29)27(28)18-24/h6-11,18,20,23,26,30H,2-5,12-17H2,1H3 |
| InChIKey | ALOFJUVJDINWSV-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.66 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|