C26H34ClFSi — CID 54729316
4-[4-(4-chloro-3-fluorophenyl)phenyl]-1-(4-propylcyclohexyl)silinane (PubChem CID 54729316) has the molecular formula C26H34ClFSi and a molecular weight of 429.10 g/mol. Its IUPAC name is 4-[4-(4-chloro-3-fluorophenyl)phenyl]-1-(4-propylcyclohexyl)silinane.
| Compound Name | 4-[4-(4-chloro-3-fluorophenyl)phenyl]-1-(4-propylcyclohexyl)silinane |
|---|---|
| PubChem CID | 54729316 |
| Molecular Formula | C26H34ClFSi |
| Molecular Weight | 429.10 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 4-[4-(4-chloro-3-fluorophenyl)phenyl]-1-(4-propylcyclohexyl)silinane |
| SMILES | CCCC1CCC([SiH]2CCC(c3ccc(-c4ccc(Cl)c(F)c4)cc3)CC2)CC1 |
| InChI | InChI=1S/C26H34ClFSi/c1-2-3-19-4-11-24(12-5-19)29-16-14-22(15-17-29)20-6-8-21(9-7-20)23-10-13-25(27)26(28)18-23/h6-10,13,18-19,22,24,29H,2-5,11-12,14-17H2,1H3 |
| InChIKey | ANSDEHHKGOJHBV-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.10 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|