C21H31ClF2Si — CID 70258911
4-(4-chlorophenyl)-1-[4-(4,4-difluorobutyl)cyclohexyl]silinane (PubChem CID 70258911) has the molecular formula C21H31ClF2Si and a molecular weight of 385.01 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-[4-(4,4-difluorobutyl)cyclohexyl]silinane.
| Compound Name | 4-(4-chlorophenyl)-1-[4-(4,4-difluorobutyl)cyclohexyl]silinane |
|---|---|
| PubChem CID | 70258911 |
| Molecular Formula | C21H31ClF2Si |
| Molecular Weight | 385.01 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 4-(4-chlorophenyl)-1-[4-(4,4-difluorobutyl)cyclohexyl]silinane |
| SMILES | FC(F)CCCC1CCC([SiH]2CCC(c3ccc(Cl)cc3)CC2)CC1 |
| InChI | InChI=1S/C21H31ClF2Si/c22-19-8-6-17(7-9-19)18-12-14-25(15-13-18)20-10-4-16(5-11-20)2-1-3-21(23)24/h6-9,16,18,20-21,25H,1-5,10-15H2 |
| InChIKey | OTTFFUJPKNCJIY-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.01 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|