C20H22BrCl — CID 23364861
1-[4-(2-bromoethyl)cyclohexyl]-4-(4-chlorophenyl)benzene (PubChem CID 23364861) has the molecular formula C20H22BrCl and a molecular weight of 377.75 g/mol. Its IUPAC name is 1-[4-(2-bromoethyl)cyclohexyl]-4-(4-chlorophenyl)benzene.
| Compound Name | 1-[4-(2-bromoethyl)cyclohexyl]-4-(4-chlorophenyl)benzene |
|---|---|
| PubChem CID | 23364861 |
| Molecular Formula | C20H22BrCl |
| Molecular Weight | 377.75 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 1-[4-(2-bromoethyl)cyclohexyl]-4-(4-chlorophenyl)benzene |
| SMILES | Clc1ccc(-c2ccc(C3CCC(CCBr)CC3)cc2)cc1 |
| InChI | InChI=1S/C20H22BrCl/c21-14-13-15-1-3-16(4-2-15)17-5-7-18(8-6-17)19-9-11-20(22)12-10-19/h5-12,15-16H,1-4,13-14H2 |
| InChIKey | NDCZNMAVNDFBGH-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.75 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|