C18H21ClN2 — CID 174329947
2-[2-[4-(4-chlorophenyl)cyclohexyl]ethyl]pyrimidine (PubChem CID 174329947) has the molecular formula C18H21ClN2 and a molecular weight of 300.83 g/mol. Its IUPAC name is 2-[2-[4-(4-chlorophenyl)cyclohexyl]ethyl]pyrimidine.
| Compound Name | 2-[2-[4-(4-chlorophenyl)cyclohexyl]ethyl]pyrimidine |
|---|---|
| PubChem CID | 174329947 |
| Molecular Formula | C18H21ClN2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-[2-[4-(4-chlorophenyl)cyclohexyl]ethyl]pyrimidine |
| SMILES | Clc1ccc(C2CCC(CCc3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C18H21ClN2/c19-17-9-7-16(8-10-17)15-5-2-14(3-6-15)4-11-18-20-12-1-13-21-18/h1,7-10,12-15H,2-6,11H2 |
| InChIKey | KEMBZWFZCSDADI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |