C29H36Cl2O — CID 174614729
1,5-bis[4-(4-chlorophenyl)cyclohexyl]pentan-3-one (PubChem CID 174614729) has the molecular formula C29H36Cl2O and a molecular weight of 471.51 g/mol. Its IUPAC name is 1,5-bis[4-(4-chlorophenyl)cyclohexyl]pentan-3-one.
| Compound Name | 1,5-bis[4-(4-chlorophenyl)cyclohexyl]pentan-3-one |
|---|---|
| PubChem CID | 174614729 |
| Molecular Formula | C29H36Cl2O |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 1,5-bis[4-(4-chlorophenyl)cyclohexyl]pentan-3-one |
| SMILES | O=C(CCC1CCC(c2ccc(Cl)cc2)CC1)CCC1CCC(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C29H36Cl2O/c30-27-15-11-25(12-16-27)23-7-1-21(2-8-23)5-19-29(32)20-6-22-3-9-24(10-4-22)26-13-17-28(31)18-14-26/h11-18,21-24H,1-10,19-20H2 |
| InChIKey | UOLXJFMGOZQEMF-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |